C16H18N2O2S — CID 7238198
(2S)-N-(4-ethylphenyl)-2-(furan-2-yl)-1,3-thiazolidine-3-carboxamide (PubChem CID 7238198) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is (2S)-N-(4-ethylphenyl)-2-(furan-2-yl)-1,3-thiazolidine-3-carboxamide.
| Compound Name | (2S)-N-(4-ethylphenyl)-2-(furan-2-yl)-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 7238198 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (2S)-N-(4-ethylphenyl)-2-(furan-2-yl)-1,3-thiazolidine-3-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCS[C@H]2c2ccco2)cc1 |
| InChI | InChI=1S/C16H18N2O2S/c1-2-12-5-7-13(8-6-12)17-16(19)18-9-11-21-15(18)14-4-3-10-20-14/h3-8,10,15H,2,9,11H2,1H3,(H,17,19)/t15-/m0/s1 |
| InChIKey | XBEUGJZAYNLPFI-HNNXBMFYSA-N |
| XLogP | 4.12 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |