C11H23N3S — CID 723829
5,5-diethyl-2-(3-methylbutyl)-1,2,4-triazolidine-3-thione (PubChem CID 723829) has the molecular formula C11H23N3S and a molecular weight of 229.39 g/mol. Its IUPAC name is 5,5-diethyl-2-(3-methylbutyl)-1,2,4-triazolidine-3-thione.
| Compound Name | 5,5-diethyl-2-(3-methylbutyl)-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 723829 |
| Molecular Formula | C11H23N3S |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 5,5-diethyl-2-(3-methylbutyl)-1,2,4-triazolidine-3-thione |
| SMILES | CCC1(CC)NC(=S)N(CCC(C)C)N1 |
| InChI | InChI=1S/C11H23N3S/c1-5-11(6-2)12-10(15)14(13-11)8-7-9(3)4/h9,13H,5-8H2,1-4H3,(H,12,15) |
| InChIKey | FXSJMOZHAYNDSS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|