C17H15NO4 — CID 723868
(2,6-dimethylphenyl) 3-(3-nitrophenyl)prop-2-enoate (PubChem CID 723868) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | (2,6-dimethylphenyl) 3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 723868 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2,6-dimethylphenyl) 3-(3-nitrophenyl)prop-2-enoate |
| SMILES | Cc1cccc(C)c1OC(=O)C=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15NO4/c1-12-5-3-6-13(2)17(12)22-16(19)10-9-14-7-4-8-15(11-14)18(20)21/h3-11H,1-2H3 |
| InChIKey | OWXXBUFQPMAGFQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|