C7H15NO — CID 7238900
(2S,3R,4R)-2,3-dimethylpiperidin-4-ol (PubChem CID 7238900) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is (2S,3R,4R)-2,3-dimethylpiperidin-4-ol.
| Compound Name | (2S,3R,4R)-2,3-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 7238900 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (2S,3R,4R)-2,3-dimethylpiperidin-4-ol |
| SMILES | C[C@H]1[C@H](O)CCN[C@H]1C |
| InChI | InChI=1S/C7H15NO/c1-5-6(2)8-4-3-7(5)9/h5-9H,3-4H2,1-2H3/t5-,6+,7-/m1/s1 |
| InChIKey | RSBKVKZYGJSCDI-DSYKOEDSSA-N |
| XLogP | 0.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |