About 1,2-dichlorobenzene
1,2-dichlorobenzene (PubChem CID 7239) has the molecular formula C6H4Cl2
and a molecular weight of 147.00 g/mol. Its IUPAC name is 1,2-dichlorobenzene.
Molecular Properties
| Compound Name | 1,2-dichlorobenzene |
| PubChem CID | 7239 |
| Molecular Formula | C6H4Cl2 |
| Molecular Weight | 147.00 g/mol |
| Exact Mass | 145.97 |
| IUPAC Name | 1,2-dichlorobenzene |
| SMILES | Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H |
| InChIKey | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.00 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorobenzene?
The IUPAC name of 1,2-dichlorobenzene (CID 7239) is 1,2-dichlorobenzene.
What is the SMILES notation for 1,2-dichlorobenzene?
The canonical SMILES for 1,2-dichlorobenzene is Clc1ccccc1Cl.
What is the InChIKey of 1,2-dichlorobenzene?
The InChIKey is RFFLAFLAYFXFSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H.
What are the key properties of 1,2-dichlorobenzene?
1,2-dichlorobenzene has a molecular weight of 147.00 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorobenzene is sourced from PubChem (CID 7239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).