About 2-benzamido-3,3-dichloroprop-2-enoic acid
2-benzamido-3,3-dichloroprop-2-enoic acid (PubChem CID 724058) has the molecular formula C10H7Cl2NO3
and a molecular weight of 260.08 g/mol. Its IUPAC name is 2-benzamido-3,3-dichloroprop-2-enoic acid.
Molecular Properties
| Compound Name | 2-benzamido-3,3-dichloroprop-2-enoic acid |
| PubChem CID | 724058 |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 2-benzamido-3,3-dichloroprop-2-enoic acid |
| SMILES | O=C(O)C(NC(=O)c1ccccc1)=C(Cl)Cl |
| InChI | InChI=1S/C10H7Cl2NO3/c11-8(12)7(10(15)16)13-9(14)6-4-2-1-3-5-6/h1-5H,(H,13,14)(H,15,16) |
| InChIKey | NXZZZPFIONENKC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-benzamido-3,3-dichloroprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamido-3,3-dichloroprop-2-enoic acid?
The IUPAC name of 2-benzamido-3,3-dichloroprop-2-enoic acid (CID 724058) is 2-benzamido-3,3-dichloroprop-2-enoic acid.
What is the SMILES notation for 2-benzamido-3,3-dichloroprop-2-enoic acid?
The canonical SMILES for 2-benzamido-3,3-dichloroprop-2-enoic acid is O=C(O)C(NC(=O)c1ccccc1)=C(Cl)Cl.
What is the InChIKey of 2-benzamido-3,3-dichloroprop-2-enoic acid?
The InChIKey is NXZZZPFIONENKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2NO3/c11-8(12)7(10(15)16)13-9(14)6-4-2-1-3-5-6/h1-5H,(H,13,14)(H,15,16).
What are the key properties of 2-benzamido-3,3-dichloroprop-2-enoic acid?
2-benzamido-3,3-dichloroprop-2-enoic acid has a molecular weight of 260.08 g/mol, XLogP of 2.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamido-3,3-dichloroprop-2-enoic acid is sourced from PubChem (CID 724058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).