2-benzamido-3,3-dichloroprop-2-enoic acid

C10H7Cl2NO3 — CID 724058

IUPAC2-benzamido-3,3-dichloroprop-2-enoic acid
SMILESO=C(O)C(NC(=O)c1ccccc1)=C(Cl)Cl
InChIInChI=1S/C10H7Cl2NO3/c11-8(12)7(10(15)16)13-9(14)6-4-2-1-3-5-6/h1-5H,(H,13,14)(H,15,16)
InChIKeyNXZZZPFIONENKC-UHFFFAOYSA-N
MW260.08 g/mol
LogP2.15
Rot. Bonds3

About 2-benzamido-3,3-dichloroprop-2-enoic acid

2-benzamido-3,3-dichloroprop-2-enoic acid (PubChem CID 724058) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is 2-benzamido-3,3-dichloroprop-2-enoic acid.

Molecular Properties

Compound Name2-benzamido-3,3-dichloroprop-2-enoic acid
PubChem CID724058
Molecular FormulaC10H7Cl2NO3
Molecular Weight260.08 g/mol
Exact Mass258.98
IUPAC Name2-benzamido-3,3-dichloroprop-2-enoic acid
SMILESO=C(O)C(NC(=O)c1ccccc1)=C(Cl)Cl
InChIInChI=1S/C10H7Cl2NO3/c11-8(12)7(10(15)16)13-9(14)6-4-2-1-3-5-6/h1-5H,(H,13,14)(H,15,16)
InChIKeyNXZZZPFIONENKC-UHFFFAOYSA-N
XLogP2.15
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.08
LogP ≤ 52.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-benzamido-3,3-dichloroprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzamido-3,3-dichloroprop-2-enoic acid?
The IUPAC name of 2-benzamido-3,3-dichloroprop-2-enoic acid (CID 724058) is 2-benzamido-3,3-dichloroprop-2-enoic acid.
What is the SMILES notation for 2-benzamido-3,3-dichloroprop-2-enoic acid?
The canonical SMILES for 2-benzamido-3,3-dichloroprop-2-enoic acid is O=C(O)C(NC(=O)c1ccccc1)=C(Cl)Cl.
What is the InChIKey of 2-benzamido-3,3-dichloroprop-2-enoic acid?
The InChIKey is NXZZZPFIONENKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2NO3/c11-8(12)7(10(15)16)13-9(14)6-4-2-1-3-5-6/h1-5H,(H,13,14)(H,15,16).
What are the key properties of 2-benzamido-3,3-dichloroprop-2-enoic acid?
2-benzamido-3,3-dichloroprop-2-enoic acid has a molecular weight of 260.08 g/mol, XLogP of 2.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamido-3,3-dichloroprop-2-enoic acid is sourced from PubChem (CID 724058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).