About (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid
(4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 724082) has the molecular formula C7H11NO3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 724082 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1(C)SC[C@@H](C(=O)O)N1C=O |
| InChI | InChI=1S/C7H11NO3S/c1-7(2)8(4-9)5(3-12-7)6(10)11/h4-5H,3H2,1-2H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | LPVHVQFTYXQKAP-YFKPBYRVSA-N |
| XLogP | 0.38 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid (CID 724082) is (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid is CC1(C)SC[C@@H](C(=O)O)N1C=O.
What is the InChIKey of (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is LPVHVQFTYXQKAP-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H11NO3S/c1-7(2)8(4-9)5(3-12-7)6(10)11/h4-5H,3H2,1-2H3,(H,10,11)/t5-/m0/s1.
What are the key properties of (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid?
(4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 189.24 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 724082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).