C14H14Cl2N4O — CID 724099
4-chloro-N-[(4-chlorophenyl)methylideneamino]-3-ethyl-1-methylpyrazole-5-carboxamide (PubChem CID 724099) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is 4-chloro-N-[(4-chlorophenyl)methylideneamino]-3-ethyl-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[(4-chlorophenyl)methylideneamino]-3-ethyl-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 724099 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 4-chloro-N-[(4-chlorophenyl)methylideneamino]-3-ethyl-1-methylpyrazole-5-carboxamide |
| SMILES | CCc1nn(C)c(C(=O)NN=Cc2ccc(Cl)cc2)c1Cl |
| InChI | InChI=1S/C14H14Cl2N4O/c1-3-11-12(16)13(20(2)19-11)14(21)18-17-8-9-4-6-10(15)7-5-9/h4-8H,3H2,1-2H3,(H,18,21) |
| InChIKey | SUVUWNFJUPQELR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|