About (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate
(2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate (PubChem CID 7241266) has the molecular formula C11H18NO4-
and a molecular weight of 228.27 g/mol. Its IUPAC name is (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate |
| PubChem CID | 7241266 |
| Molecular Formula | C11H18NO4- |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)C(=O)N1CCC[C@@]1(CO)C(=O)[O-] |
| InChI | InChI=1S/C11H19NO4/c1-10(2,3)8(14)12-6-4-5-11(12,7-13)9(15)16/h13H,4-7H2,1-3H3,(H,15,16)/p-1/t11-/m1/s1 |
| InChIKey | SPCAWXFTTUXKQI-LLVKDONJSA-M |
| XLogP | -0.86 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate?
The IUPAC name of (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate (CID 7241266) is (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate?
The canonical SMILES for (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate is CC(C)(C)C(=O)N1CCC[C@@]1(CO)C(=O)[O-].
What is the InChIKey of (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate?
The InChIKey is SPCAWXFTTUXKQI-LLVKDONJSA-M. The full InChI is InChI=1S/C11H19NO4/c1-10(2,3)8(14)12-6-4-5-11(12,7-13)9(15)16/h13H,4-7H2,1-3H3,(H,15,16)/p-1/t11-/m1/s1.
What are the key properties of (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate?
(2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate has a molecular weight of 228.27 g/mol, XLogP of -0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(2,2-dimethylpropanoyl)-2-(hydroxymethyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 7241266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).