C21H20FN5 — CID 7241278
(3R,5R,8R,8aS)-8-(4-fluorophenyl)-6-imino-2,3,8a-trimethyl-1,3,5,8-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 7241278) has the molecular formula C21H20FN5 and a molecular weight of 361.42 g/mol. Its IUPAC name is (3R,5R,8R,8aS)-8-(4-fluorophenyl)-6-imino-2,3,8a-trimethyl-1,3,5,8-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (3R,5R,8R,8aS)-8-(4-fluorophenyl)-6-imino-2,3,8a-trimethyl-1,3,5,8-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7241278 |
| Molecular Formula | C21H20FN5 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (3R,5R,8R,8aS)-8-(4-fluorophenyl)-6-imino-2,3,8a-trimethyl-1,3,5,8-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)C2=C[C@@H](C)N(C)C[C@@]2(C)[C@@H](c2ccc(F)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C21H20FN5/c1-13-8-17-16(9-23)19(26)21(10-24,11-25)18(20(17,2)12-27(13)3)14-4-6-15(22)7-5-14/h4-8,13,16,18,26H,12H2,1-3H3/b26-19+/t13-,16-,18-,20-/m1/s1 |
| InChIKey | YEMZUYNEPGVQBB-DSWWPVLVSA-N |
| XLogP | 3.38 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|