C20H24ClN3O3S — CID 7241806
(3Z)-3-[(4-tert-butylphenyl)sulfonylhydrazinylidene]-N-(4-chlorophenyl)butanamide (PubChem CID 7241806) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is (3Z)-3-[(4-tert-butylphenyl)sulfonylhydrazinylidene]-N-(4-chlorophenyl)butanamide.
| Compound Name | (3Z)-3-[(4-tert-butylphenyl)sulfonylhydrazinylidene]-N-(4-chlorophenyl)butanamide |
|---|---|
| PubChem CID | 7241806 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (3Z)-3-[(4-tert-butylphenyl)sulfonylhydrazinylidene]-N-(4-chlorophenyl)butanamide |
| SMILES | C/C(CC(=O)Nc1ccc(Cl)cc1)=N/NS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H24ClN3O3S/c1-14(13-19(25)22-17-9-7-16(21)8-10-17)23-24-28(26,27)18-11-5-15(6-12-18)20(2,3)4/h5-12,24H,13H2,1-4H3,(H,22,25)/b23-14- |
| InChIKey | HKIOPJLLFYCNEJ-UCQKPKSFSA-N |
| XLogP | 4.32 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|