C14H17NO4 — CID 7242054
ethyl 2-[(2S)-2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate (PubChem CID 7242054) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is ethyl 2-[(2S)-2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate.
| Compound Name | ethyl 2-[(2S)-2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate |
|---|---|
| PubChem CID | 7242054 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethyl 2-[(2S)-2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)[C@H](C)Oc2ccc(C)cc21 |
| InChI | InChI=1S/C14H17NO4/c1-4-18-13(16)8-15-11-7-9(2)5-6-12(11)19-10(3)14(15)17/h5-7,10H,4,8H2,1-3H3/t10-/m0/s1 |
| InChIKey | KRAPSELQVMPIBM-JTQLQIEISA-N |
| XLogP | 1.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |