About cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium
cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium (PubChem CID 7242839) has the molecular formula C14H20F2N+
and a molecular weight of 240.32 g/mol. Its IUPAC name is cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium.
Molecular Properties
| Compound Name | cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium |
| PubChem CID | 7242839 |
| Molecular Formula | C14H20F2N+ |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium |
| SMILES | CCC[NH+](Cc1c(F)cccc1F)CC1CC1 |
| InChI | InChI=1S/C14H19F2N/c1-2-8-17(9-11-6-7-11)10-12-13(15)4-3-5-14(12)16/h3-5,11H,2,6-10H2,1H3/p+1 |
| InChIKey | KGLSVSJAGOESQY-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium?
The IUPAC name of cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium (CID 7242839) is cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium.
What is the SMILES notation for cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium?
The canonical SMILES for cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium is CCC[NH+](Cc1c(F)cccc1F)CC1CC1.
What is the InChIKey of cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium?
The InChIKey is KGLSVSJAGOESQY-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H19F2N/c1-2-8-17(9-11-6-7-11)10-12-13(15)4-3-5-14(12)16/h3-5,11H,2,6-10H2,1H3/p+1.
What are the key properties of cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium?
cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium has a molecular weight of 240.32 g/mol, XLogP of 2.17, 6 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl-[(2,6-difluorophenyl)methyl]-propylazanium is sourced from PubChem (CID 7242839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).