C21H25Cl2N2O+ — CID 7243110
(NE)-N-[(2S,3S,5S,6S)-2,6-bis(4-chlorophenyl)-3-methyl-5-propylpiperidin-1-ium-4-ylidene]hydroxylamine (PubChem CID 7243110) has the molecular formula C21H25Cl2N2O+ and a molecular weight of 392.35 g/mol. Its IUPAC name is (NE)-N-[(2S,3S,5S,6S)-2,6-bis(4-chlorophenyl)-3-methyl-5-propylpiperidin-1-ium-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2S,3S,5S,6S)-2,6-bis(4-chlorophenyl)-3-methyl-5-propylpiperidin-1-ium-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7243110 |
| Molecular Formula | C21H25Cl2N2O+ |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (NE)-N-[(2S,3S,5S,6S)-2,6-bis(4-chlorophenyl)-3-methyl-5-propylpiperidin-1-ium-4-ylidene]hydroxylamine |
| SMILES | CCC[C@@H]1/C(=N/O)[C@@H](C)[C@@H](c2ccc(Cl)cc2)[NH2+][C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O/c1-3-4-18-20(25-26)13(2)19(14-5-9-16(22)10-6-14)24-21(18)15-7-11-17(23)12-8-15/h5-13,18-19,21,24,26H,3-4H2,1-2H3/p+1/b25-20+/t13-,18+,19-,21+/m0/s1 |
| InChIKey | WETLHCJOVDJFEY-IASVRHMXSA-O |
| XLogP | 5.24 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|