C17H28O4S2 — CID 7245014
(1S,4R,5R,6S)-5-butylsulfonyl-6-[(E)-2-butylsulfonylethenyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 7245014) has the molecular formula C17H28O4S2 and a molecular weight of 360.54 g/mol. Its IUPAC name is (1S,4R,5R,6S)-5-butylsulfonyl-6-[(E)-2-butylsulfonylethenyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R,5R,6S)-5-butylsulfonyl-6-[(E)-2-butylsulfonylethenyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 7245014 |
| Molecular Formula | C17H28O4S2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (1S,4R,5R,6S)-5-butylsulfonyl-6-[(E)-2-butylsulfonylethenyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | CCCCS(=O)(=O)/C=C/[C@H]1[C@H](S(=O)(=O)CCCC)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C17H28O4S2/c1-3-5-10-22(18,19)12-9-16-14-7-8-15(13-14)17(16)23(20,21)11-6-4-2/h7-9,12,14-17H,3-6,10-11,13H2,1-2H3/b12-9+/t14-,15+,16-,17-/m1/s1 |
| InChIKey | JXCBAZUXWWKMNG-YUNSMIQESA-N |
| XLogP | 3.12 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|