About 4-bromo-1H-pyrazole-3,5-dicarboxylate
4-bromo-1H-pyrazole-3,5-dicarboxylate (PubChem CID 7245050) has the molecular formula C5HBrN2O4-2
and a molecular weight of 232.98 g/mol. Its IUPAC name is 4-bromo-1H-pyrazole-3,5-dicarboxylate.
Molecular Properties
| Compound Name | 4-bromo-1H-pyrazole-3,5-dicarboxylate |
| PubChem CID | 7245050 |
| Molecular Formula | C5HBrN2O4-2 |
| Molecular Weight | 232.98 g/mol |
| Exact Mass | 231.91 |
| IUPAC Name | 4-bromo-1H-pyrazole-3,5-dicarboxylate |
| SMILES | O=C([O-])c1n[nH]c(C(=O)[O-])c1Br |
| InChI | InChI=1S/C5H3BrN2O4/c6-1-2(4(9)10)7-8-3(1)5(11)12/h(H,7,8)(H,9,10)(H,11,12)/p-2 |
| InChIKey | MIBYVSCTDVIFKG-UHFFFAOYSA-L |
| XLogP | -2.10 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.98 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-bromo-1H-pyrazole-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1H-pyrazole-3,5-dicarboxylate?
The IUPAC name of 4-bromo-1H-pyrazole-3,5-dicarboxylate (CID 7245050) is 4-bromo-1H-pyrazole-3,5-dicarboxylate.
What is the SMILES notation for 4-bromo-1H-pyrazole-3,5-dicarboxylate?
The canonical SMILES for 4-bromo-1H-pyrazole-3,5-dicarboxylate is O=C([O-])c1n[nH]c(C(=O)[O-])c1Br.
What is the InChIKey of 4-bromo-1H-pyrazole-3,5-dicarboxylate?
The InChIKey is MIBYVSCTDVIFKG-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H3BrN2O4/c6-1-2(4(9)10)7-8-3(1)5(11)12/h(H,7,8)(H,9,10)(H,11,12)/p-2.
What are the key properties of 4-bromo-1H-pyrazole-3,5-dicarboxylate?
4-bromo-1H-pyrazole-3,5-dicarboxylate has a molecular weight of 232.98 g/mol, XLogP of -2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1H-pyrazole-3,5-dicarboxylate is sourced from PubChem (CID 7245050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).