C16H18N4O — CID 7245059
1-[(1R,3R,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexyl]ethane-1,1,2,2-tetracarbonitrile (PubChem CID 7245059) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-[(1R,3R,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexyl]ethane-1,1,2,2-tetracarbonitrile.
| Compound Name | 1-[(1R,3R,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexyl]ethane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 7245059 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-[(1R,3R,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexyl]ethane-1,1,2,2-tetracarbonitrile |
| SMILES | CC(C)[C@H]1CC[C@H](C)[C@H](C(C#N)(C#N)C(C#N)C#N)C1=O |
| InChI | InChI=1S/C16H18N4O/c1-10(2)13-5-4-11(3)14(15(13)21)16(8-19,9-20)12(6-17)7-18/h10-14H,4-5H2,1-3H3/t11-,13+,14-/m0/s1 |
| InChIKey | RXUGENCIFOVTBC-YUTCNCBUSA-N |
| XLogP | 2.57 |
| TPSA | 112.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|