About 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene
5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene (PubChem CID 7245114) has the molecular formula C4H2BrN6-
and a molecular weight of 214.01 g/mol. Its IUPAC name is 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene.
Molecular Properties
| Compound Name | 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene |
| PubChem CID | 7245114 |
| Molecular Formula | C4H2BrN6- |
| Molecular Weight | 214.01 g/mol |
| Exact Mass | 212.95 |
| IUPAC Name | 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene |
| SMILES | Brc1cnn(-c2nnn[n-]2)c1 |
| InChI | InChI=1S/C4H2BrN6/c5-3-1-6-11(2-3)4-7-9-10-8-4/h1-2H/q-1 |
| InChIKey | WKHFCMWVSXPVBK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 70.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.01 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene?
The IUPAC name of 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene (CID 7245114) is 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene.
What is the SMILES notation for 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene?
The canonical SMILES for 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene is Brc1cnn(-c2nnn[n-]2)c1.
What is the InChIKey of 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene?
The InChIKey is WKHFCMWVSXPVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrN6/c5-3-1-6-11(2-3)4-7-9-10-8-4/h1-2H/q-1.
What are the key properties of 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene?
5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene has a molecular weight of 214.01 g/mol, XLogP of -0.22, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromopyrazol-1-yl)-1,2,3-triaza-4-azanidacyclopenta-2,5-diene is sourced from PubChem (CID 7245114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).