C8H7Cl2N3S — CID 7245305
[(E)-(2,6-dichlorophenyl)methylideneamino]thiourea (PubChem CID 7245305) has the molecular formula C8H7Cl2N3S and a molecular weight of 248.14 g/mol. Its IUPAC name is [(E)-(2,6-dichlorophenyl)methylideneamino]thiourea.
| Compound Name | [(E)-(2,6-dichlorophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 7245305 |
| Molecular Formula | C8H7Cl2N3S |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | [(E)-(2,6-dichlorophenyl)methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H7Cl2N3S/c9-6-2-1-3-7(10)5(6)4-12-13-8(11)14/h1-4H,(H3,11,13,14)/b12-4+ |
| InChIKey | JWTQZQFPOKSWPZ-UUILKARUSA-N |
| XLogP | 2.16 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|