C12H14ClN3S — CID 724561
3-[(2-chlorophenyl)methylsulfanyl]-5-propyl-1H-1,2,4-triazole (PubChem CID 724561) has the molecular formula C12H14ClN3S and a molecular weight of 267.78 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylsulfanyl]-5-propyl-1H-1,2,4-triazole.
| Compound Name | 3-[(2-chlorophenyl)methylsulfanyl]-5-propyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 724561 |
| Molecular Formula | C12H14ClN3S |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3-[(2-chlorophenyl)methylsulfanyl]-5-propyl-1H-1,2,4-triazole |
| SMILES | CCCc1nc(SCc2ccccc2Cl)n[nH]1 |
| InChI | InChI=1S/C12H14ClN3S/c1-2-5-11-14-12(16-15-11)17-8-9-6-3-4-7-10(9)13/h3-4,6-7H,2,5,8H2,1H3,(H,14,15,16) |
| InChIKey | NNMNFKQMDNPDNV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |