C17H12Cl2N4O2 — CID 7245808
(3aR,6aS)-5-(4-chlorophenyl)-3-[(2-chlorophenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 7245808) has the molecular formula C17H12Cl2N4O2 and a molecular weight of 375.22 g/mol. Its IUPAC name is (3aR,6aS)-5-(4-chlorophenyl)-3-[(2-chlorophenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aR,6aS)-5-(4-chlorophenyl)-3-[(2-chlorophenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 7245808 |
| Molecular Formula | C17H12Cl2N4O2 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (3aR,6aS)-5-(4-chlorophenyl)-3-[(2-chlorophenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | O=C1[C@H]2N=NN(Cc3ccccc3Cl)[C@H]2C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12Cl2N4O2/c18-11-5-7-12(8-6-11)23-16(24)14-15(17(23)25)22(21-20-14)9-10-3-1-2-4-13(10)19/h1-8,14-15H,9H2/t14-,15+/m0/s1 |
| InChIKey | ZBCKAZLUKVNXJG-LSDHHAIUSA-N |
| XLogP | 3.49 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|