About 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one
3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one (PubChem CID 7246282) has the molecular formula C15H7ClF2O4S
and a molecular weight of 356.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one |
| PubChem CID | 7246282 |
| Molecular Formula | C15H7ClF2O4S |
| Molecular Weight | 356.73 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one |
| SMILES | O=c1oc2c(F)cc(F)cc2cc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H7ClF2O4S/c16-9-1-3-11(4-2-9)23(20,21)13-6-8-5-10(17)7-12(18)14(8)22-15(13)19/h1-7H |
| InChIKey | LKWSPUZLBXHDDL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one?
The IUPAC name of 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one (CID 7246282) is 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one.
What is the SMILES notation for 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one?
The canonical SMILES for 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one is O=c1oc2c(F)cc(F)cc2cc1S(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one?
The InChIKey is LKWSPUZLBXHDDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7ClF2O4S/c16-9-1-3-11(4-2-9)23(20,21)13-6-8-5-10(17)7-12(18)14(8)22-15(13)19/h1-7H.
What are the key properties of 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one?
3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one has a molecular weight of 356.73 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)sulfonyl-6,8-difluorochromen-2-one is sourced from PubChem (CID 7246282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).