C20H20N4OS — CID 7246599
N-(2-cyanoethyl)-2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-phenylacetamide (PubChem CID 7246599) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-phenylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 7246599 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-(2-cyanoethyl)-2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-phenylacetamide |
| SMILES | CCn1c(SCC(=O)N(CCC#N)c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C20H20N4OS/c1-2-23-18-12-7-6-11-17(18)22-20(23)26-15-19(25)24(14-8-13-21)16-9-4-3-5-10-16/h3-7,9-12H,2,8,14-15H2,1H3 |
| InChIKey | JMIPIIAEVRQYJO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |