C17H15F2N3OS — CID 7246603
N-(2,6-difluorophenyl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 7246603) has the molecular formula C17H15F2N3OS and a molecular weight of 347.39 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7246603 |
| Molecular Formula | C17H15F2N3OS |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | CCn1c(SCC(=O)Nc2c(F)cccc2F)nc2ccccc21 |
| InChI | InChI=1S/C17H15F2N3OS/c1-2-22-14-9-4-3-8-13(14)20-17(22)24-10-15(23)21-16-11(18)6-5-7-12(16)19/h3-9H,2,10H2,1H3,(H,21,23) |
| InChIKey | RCSSYJOFMTVYAI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |