C18H21N5O3S — CID 7247473
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetamide (PubChem CID 7247473) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7247473 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1ccc2nc(SCC(=O)NN3C(=O)NC4(CCCCC4)C3=O)[nH]c2c1 |
| InChI | InChI=1S/C18H21N5O3S/c1-11-5-6-12-13(9-11)20-16(19-12)27-10-14(24)22-23-15(25)18(21-17(23)26)7-3-2-4-8-18/h5-6,9H,2-4,7-8,10H2,1H3,(H,19,20)(H,21,26)(H,22,24) |
| InChIKey | WQUUACPFWYFHJI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|