C16H17FN5O3+ — CID 7248419
2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[[5-(4-fluorophenyl)furan-2-yl]methyl]azanium (PubChem CID 7248419) has the molecular formula C16H17FN5O3+ and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[[5-(4-fluorophenyl)furan-2-yl]methyl]azanium.
| Compound Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[[5-(4-fluorophenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7248419 |
| Molecular Formula | C16H17FN5O3+ |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[[5-(4-fluorophenyl)furan-2-yl]methyl]azanium |
| SMILES | Nc1nonc1C(=O)NCC[NH2+]Cc1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C16H16FN5O3/c17-11-3-1-10(2-4-11)13-6-5-12(24-13)9-19-7-8-20-16(23)14-15(18)22-25-21-14/h1-6,19H,7-9H2,(H2,18,22)(H,20,23)/p+1 |
| InChIKey | MLUHOKMRGWMTNV-UHFFFAOYSA-O |
| XLogP | 0.54 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|