C15H15NO4 — CID 7248702
(4R)-4-(furan-2-yl)-6,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 7248702) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (4R)-4-(furan-2-yl)-6,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | (4R)-4-(furan-2-yl)-6,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 7248702 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (4R)-4-(furan-2-yl)-6,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccco1)CC(=O)N2 |
| InChI | InChI=1S/C15H15NO4/c1-18-13-6-9-10(12-4-3-5-20-12)7-15(17)16-11(9)8-14(13)19-2/h3-6,8,10H,7H2,1-2H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | SVMGCGXKNWSLRV-SNVBAGLBSA-N |
| XLogP | 2.77 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |