C18H16N2O3S — CID 724907
4-[(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]benzoic acid (PubChem CID 724907) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-[(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]benzoic acid.
| Compound Name | 4-[(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 724907 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 4-[(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cn2cnc3sc4c(c3c2=O)CCCC4)cc1 |
| InChI | InChI=1S/C18H16N2O3S/c21-17-15-13-3-1-2-4-14(13)24-16(15)19-10-20(17)9-11-5-7-12(8-6-11)18(22)23/h5-8,10H,1-4,9H2,(H,22,23) |
| InChIKey | DROOLDSOLTXUQB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_pyridone_A(3)', 'substructure': 'N/A'} |
|---|