C22H22ClN3O3 — CID 7249274
(2R)-2-chloro-1-[(2R)-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-phenylethanone (PubChem CID 7249274) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is (2R)-2-chloro-1-[(2R)-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-phenylethanone.
| Compound Name | (2R)-2-chloro-1-[(2R)-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 7249274 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (2R)-2-chloro-1-[(2R)-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-phenylethanone |
| SMILES | COc1cccc(-c2noc([C@H]3CCCCN3C(=O)[C@H](Cl)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-28-17-11-7-10-16(14-17)20-24-21(29-25-20)18-12-5-6-13-26(18)22(27)19(23)15-8-3-2-4-9-15/h2-4,7-11,14,18-19H,5-6,12-13H2,1H3/t18-,19-/m1/s1 |
| InChIKey | MLEQFQPQHDQHFH-RTBURBONSA-N |
| XLogP | 4.78 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|