C15H19FN5S+ — CID 7249782
[(1R)-1-[5-(2-cyanoethylsulfanyl)-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]ethyl]-dimethylazanium (PubChem CID 7249782) has the molecular formula C15H19FN5S+ and a molecular weight of 320.42 g/mol. Its IUPAC name is [(1R)-1-[5-(2-cyanoethylsulfanyl)-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-[5-(2-cyanoethylsulfanyl)-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7249782 |
| Molecular Formula | C15H19FN5S+ |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(1R)-1-[5-(2-cyanoethylsulfanyl)-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]ethyl]-dimethylazanium |
| SMILES | C[C@H](c1nnc(SCCC#N)n1-c1ccc(F)cc1)[NH+](C)C |
| InChI | InChI=1S/C15H18FN5S/c1-11(20(2)3)14-18-19-15(22-10-4-9-17)21(14)13-7-5-12(16)6-8-13/h5-8,11H,4,10H2,1-3H3/p+1/t11-/m1/s1 |
| InChIKey | OKLVGCYRTXWGKX-LLVKDONJSA-O |
| XLogP | 1.62 |
| TPSA | 58.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|