C36H40ClN4O7S2+ — CID 72504851
4-[5-chloro-6-cyano-3-ethyl-2-[2-[[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]benzimidazol-1-yl]butane-1-sulfonic acid (PubChem CID 72504851) has the molecular formula C36H40ClN4O7S2+ and a molecular weight of 740.32 g/mol. Its IUPAC name is 4-[5-chloro-6-cyano-3-ethyl-2-[2-[[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]benzimidazol-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[5-chloro-6-cyano-3-ethyl-2-[2-[[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]benzimidazol-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 72504851 |
| Molecular Formula | C36H40ClN4O7S2+ |
| Molecular Weight | 740.32 g/mol |
| Exact Mass | 739.20 |
| IUPAC Name | 4-[5-chloro-6-cyano-3-ethyl-2-[2-[[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]benzimidazol-1-yl]butane-1-sulfonic acid |
| SMILES | CCC(=Cc1oc2ccc(-c3ccccc3)cc2[n+]1CCCCS(=O)(=O)O)C=C1N(CC)c2cc(Cl)c(C#N)cc2N1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C36H39ClN4O7S2/c1-3-26(20-35-39(4-2)32-24-30(37)29(25-38)23-31(32)40(35)16-8-10-18-49(42,43)44)21-36-41(17-9-11-19-50(45,46)47)33-22-28(14-15-34(33)48-36)27-12-6-5-7-13-27/h5-7,12-15,20-24H,3-4,8-11,16-19H2,1-2H3,(H-,42,43,44,45,46,47)/p+1 |
| InChIKey | LRCPESUYFGXOIY-UHFFFAOYSA-O |
| XLogP | 7.23 |
| TPSA | 156.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.32 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|