C22H27NO2 — CID 72505231
5-(hydroxyiminomethyl)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenol (PubChem CID 72505231) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 5-(hydroxyiminomethyl)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenol.
| Compound Name | 5-(hydroxyiminomethyl)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenol |
|---|---|
| PubChem CID | 72505231 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 5-(hydroxyiminomethyl)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenol |
| SMILES | Cc1cc2c(cc1-c1ccc(C=NO)cc1O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H27NO2/c1-14-10-18-19(22(4,5)9-8-21(18,2)3)12-17(14)16-7-6-15(13-23-25)11-20(16)24/h6-7,10-13,24-25H,8-9H2,1-5H3 |
| InChIKey | XDBDYUILKDBARK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|