About 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one
4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one (PubChem CID 7250870) has the molecular formula C23H22N2O2S
and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one.
Molecular Properties
| Compound Name | 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one |
| PubChem CID | 7250870 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nc(Cc4ccccc4)c(C)[nH]3)c2cc1C |
| InChI | InChI=1S/C23H22N2O2S/c1-14-9-19-18(12-22(26)27-21(19)10-15(14)2)13-28-23-24-16(3)20(25-23)11-17-7-5-4-6-8-17/h4-10,12H,11,13H2,1-3H3,(H,24,25) |
| InChIKey | RDWHBNVRXDGBMI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one?
The IUPAC name of 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one (CID 7250870) is 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one.
What is the SMILES notation for 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one?
The canonical SMILES for 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one is Cc1cc2oc(=O)cc(CSc3nc(Cc4ccccc4)c(C)[nH]3)c2cc1C.
What is the InChIKey of 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one?
The InChIKey is RDWHBNVRXDGBMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O2S/c1-14-9-19-18(12-22(26)27-21(19)10-15(14)2)13-28-23-24-16(3)20(25-23)11-17-7-5-4-6-8-17/h4-10,12H,11,13H2,1-3H3,(H,24,25).
What are the key properties of 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one?
4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one has a molecular weight of 390.51 g/mol, XLogP of 5.32, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one is sourced from PubChem (CID 7250870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).