About 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole
4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole (PubChem CID 7250899) has the molecular formula C18H16Cl2N2S
and a molecular weight of 363.31 g/mol. Its IUPAC name is 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole.
Molecular Properties
| Compound Name | 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole |
| PubChem CID | 7250899 |
| Molecular Formula | C18H16Cl2N2S |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole |
| SMILES | Cc1[nH]c(SCc2c(Cl)cccc2Cl)nc1Cc1ccccc1 |
| InChI | InChI=1S/C18H16Cl2N2S/c1-12-17(10-13-6-3-2-4-7-13)22-18(21-12)23-11-14-15(19)8-5-9-16(14)20/h2-9H,10-11H2,1H3,(H,21,22) |
| InChIKey | PMQGYIVGCLSCDI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole?
The IUPAC name of 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole (CID 7250899) is 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole.
What is the SMILES notation for 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole?
The canonical SMILES for 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole is Cc1[nH]c(SCc2c(Cl)cccc2Cl)nc1Cc1ccccc1.
What is the InChIKey of 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole?
The InChIKey is PMQGYIVGCLSCDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2N2S/c1-12-17(10-13-6-3-2-4-7-13)22-18(21-12)23-11-14-15(19)8-5-9-16(14)20/h2-9H,10-11H2,1H3,(H,21,22).
What are the key properties of 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole?
4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole has a molecular weight of 363.31 g/mol, XLogP of 5.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2-[(2,6-dichlorophenyl)methylsulfanyl]-5-methyl-1H-imidazole is sourced from PubChem (CID 7250899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).