C24H30O3 — CID 72509008
5-(7-cyclohexyl-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid (PubChem CID 72509008) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 5-(7-cyclohexyl-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-(7-cyclohexyl-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 72509008 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 5-(7-cyclohexyl-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(C=CC1=CC(C)(C)COc2ccc(C3CCCCC3)cc21)=CC(=O)O |
| InChI | InChI=1S/C24H30O3/c1-17(13-23(25)26)9-10-20-15-24(2,3)16-27-22-12-11-19(14-21(20)22)18-7-5-4-6-8-18/h9-15,18H,4-8,16H2,1-3H3,(H,25,26) |
| InChIKey | DNPVJAFUHGBEKW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|