About 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine
1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine (PubChem CID 72509688) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine.
Molecular Properties
| Compound Name | 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine |
| PubChem CID | 72509688 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine |
| SMILES | CON=C(C)C1=NOCCO1 |
| InChI | InChI=1S/C6H10N2O3/c1-5(7-9-2)6-8-11-4-3-10-6/h3-4H2,1-2H3 |
| InChIKey | KZHIWGPIWVANPY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine?
The IUPAC name of 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine (CID 72509688) is 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine.
What is the SMILES notation for 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine?
The canonical SMILES for 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine is CON=C(C)C1=NOCCO1.
What is the InChIKey of 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine?
The InChIKey is KZHIWGPIWVANPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c1-5(7-9-2)6-8-11-4-3-10-6/h3-4H2,1-2H3.
What are the key properties of 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine?
1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine has a molecular weight of 158.16 g/mol, XLogP of 0.37, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxyethanimine is sourced from PubChem (CID 72509688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).