C17H22N4O5 — CID 7251254
[(3R)-3-cyano-4-imino-2-oxopentyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 7251254) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is [(3R)-3-cyano-4-imino-2-oxopentyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 7251254 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)COC(=O)CN1C(=O)N[C@]2(CCCC[C@H]2C)C1=O |
| InChI | InChI=1S/C17H22N4O5/c1-10-5-3-4-6-17(10)15(24)21(16(25)20-17)8-14(23)26-9-13(22)12(7-18)11(2)19/h10,12,19H,3-6,8-9H2,1-2H3,(H,20,25)/b19-11+/t10-,12+,17+/m1/s1 |
| InChIKey | YRUBVQNFTNNCLC-HKMAUCNJSA-N |
| XLogP | 0.78 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|