C22H30N3O11- — CID 72513124
1-(2,5-dioxopyrrolidin-1-yl)oxy-2-[2-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propoxy]ethoxy]ethoxy]propylamino]-2-oxoethoxy]ethenolate (PubChem CID 72513124) has the molecular formula C22H30N3O11- and a molecular weight of 512.49 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)oxy-2-[2-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propoxy]ethoxy]ethoxy]propylamino]-2-oxoethoxy]ethenolate.
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)oxy-2-[2-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propoxy]ethoxy]ethoxy]propylamino]-2-oxoethoxy]ethenolate |
|---|---|
| PubChem CID | 72513124 |
| Molecular Formula | C22H30N3O11- |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)oxy-2-[2-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propoxy]ethoxy]ethoxy]propylamino]-2-oxoethoxy]ethenolate |
| SMILES | O=C(COC=C([O-])ON1C(=O)CCC1=O)NCCCOCCOCCOCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H31N3O11/c26-17(15-35-16-22(31)36-25-20(29)5-6-21(25)30)23-7-1-9-32-11-13-34-14-12-33-10-2-8-24-18(27)3-4-19(24)28/h3-4,16,31H,1-2,5-15H2,(H,23,26)/p-1 |
| InChIKey | WXZAJXPYMKQKMW-UHFFFAOYSA-M |
| XLogP | -1.89 |
| TPSA | 173.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|