C35H33N5OS — CID 72515067
3-[[5-[[3-[2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]thiophen-2-yl]methylidene]-5-isocyanopenta-1,4-diene-1,1,5-tricarbonitrile (PubChem CID 72515067) has the molecular formula C35H33N5OS and a molecular weight of 571.75 g/mol. Its IUPAC name is 3-[[5-[[3-[2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]thiophen-2-yl]methylidene]-5-isocyanopenta-1,4-diene-1,1,5-tricarbonitrile.
| Compound Name | 3-[[5-[[3-[2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]thiophen-2-yl]methylidene]-5-isocyanopenta-1,4-diene-1,1,5-tricarbonitrile |
|---|---|
| PubChem CID | 72515067 |
| Molecular Formula | C35H33N5OS |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 3-[[5-[[3-[2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]thiophen-2-yl]methylidene]-5-isocyanopenta-1,4-diene-1,1,5-tricarbonitrile |
| SMILES | [C-]#[N+]C(C#N)=CC(C=C(C#N)C#N)=Cc1ccc(C=C2C=C(C=Cc3ccc(N(CC)CCO)cc3)CC(C)(C)C2)s1 |
| InChI | InChI=1S/C35H33N5OS/c1-5-40(14-15-41)32-10-8-26(9-11-32)6-7-27-16-29(22-35(2,3)21-27)20-34-13-12-33(42-34)19-28(17-30(23-36)24-37)18-31(25-38)39-4/h6-13,16-20,41H,5,14-15,21-22H2,1-3H3 |
| InChIKey | LGDHXCLEBMCNGR-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|