About 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione
3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione (PubChem CID 725181) has the molecular formula C10H3Cl3FNO2
and a molecular weight of 294.50 g/mol. Its IUPAC name is 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione |
| PubChem CID | 725181 |
| Molecular Formula | C10H3Cl3FNO2 |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 292.92 |
| IUPAC Name | 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)N1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H3Cl3FNO2/c11-5-3-4(1-2-6(5)14)15-9(16)7(12)8(13)10(15)17/h1-3H |
| InChIKey | INKZIMLFRJNJEB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione?
The IUPAC name of 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione (CID 725181) is 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione.
What is the SMILES notation for 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione?
The canonical SMILES for 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione is O=C1C(Cl)=C(Cl)C(=O)N1c1ccc(F)c(Cl)c1.
What is the InChIKey of 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione?
The InChIKey is INKZIMLFRJNJEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3Cl3FNO2/c11-5-3-4(1-2-6(5)14)15-9(16)7(12)8(13)10(15)17/h1-3H.
What are the key properties of 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione?
3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione has a molecular weight of 294.50 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione is sourced from PubChem (CID 725181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).