C28H27N3O — CID 72518754
2-[6-[2-(8-ethyl-1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethenyl]-2-phenyl-2,3-dihydropyran-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 72518754) has the molecular formula C28H27N3O and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[6-[2-(8-ethyl-1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethenyl]-2-phenyl-2,3-dihydropyran-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[6-[2-(8-ethyl-1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethenyl]-2-phenyl-2,3-dihydropyran-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 72518754 |
| Molecular Formula | C28H27N3O |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 2-[6-[2-(8-ethyl-1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethenyl]-2-phenyl-2,3-dihydropyran-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1C=C(C=Cc2cc(CC)c3c(c2)CCCN3C)OC(c2ccccc2)C1 |
| InChI | InChI=1S/C28H27N3O/c1-4-21-15-20(16-23-11-8-14-31(3)28(21)23)12-13-25-17-24(26(19-29)30-2)18-27(32-25)22-9-6-5-7-10-22/h5-7,9-10,12-13,15-17,27H,4,8,11,14,18H2,1,3H3 |
| InChIKey | NLVXMKCUAFFXFQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|