C18H30N3+ — CID 72519405
[9-(dimethylamino)-5-[2-(dimethylamino)prop-1-enyl]nona-2,4,6,8-tetraenylidene]-dimethylazanium (PubChem CID 72519405) has the molecular formula C18H30N3+ and a molecular weight of 288.46 g/mol. Its IUPAC name is [9-(dimethylamino)-5-[2-(dimethylamino)prop-1-enyl]nona-2,4,6,8-tetraenylidene]-dimethylazanium.
| Compound Name | [9-(dimethylamino)-5-[2-(dimethylamino)prop-1-enyl]nona-2,4,6,8-tetraenylidene]-dimethylazanium |
|---|---|
| PubChem CID | 72519405 |
| Molecular Formula | C18H30N3+ |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | [9-(dimethylamino)-5-[2-(dimethylamino)prop-1-enyl]nona-2,4,6,8-tetraenylidene]-dimethylazanium |
| SMILES | CC(=CC(C=CC=CN(C)C)=CC=CC=[N+](C)C)N(C)C |
| InChI | InChI=1S/C18H30N3/c1-17(21(6)7)16-18(12-8-10-14-19(2)3)13-9-11-15-20(4)5/h8-16H,1-7H3/q+1 |
| InChIKey | ZUNPXKHHYAXQSX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|