C16H29NOSi — CID 72519682
N-[dimethyl-[(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]silyl]-2-methylpropan-2-amine (PubChem CID 72519682) has the molecular formula C16H29NOSi and a molecular weight of 279.50 g/mol. Its IUPAC name is N-[dimethyl-[(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]silyl]-2-methylpropan-2-amine.
| Compound Name | N-[dimethyl-[(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 72519682 |
| Molecular Formula | C16H29NOSi |
| Molecular Weight | 279.50 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-[dimethyl-[(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]silyl]-2-methylpropan-2-amine |
| SMILES | CC1CC2C=CC=CC2C1O[Si](C)(C)NC(C)(C)C |
| InChI | InChI=1S/C16H29NOSi/c1-12-11-13-9-7-8-10-14(13)15(12)18-19(5,6)17-16(2,3)4/h7-10,12-15,17H,11H2,1-6H3 |
| InChIKey | CYZCKTPBNCCWME-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|