C31H30FN2O6S3+ — CID 72519824
2-[2-[[5,5-dimethyl-3-[[1-(3-sulfopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]cyclohexen-1-yl]methylidene]-5-fluoro-1,3-benzothiazol-3-yl]acetic acid (PubChem CID 72519824) has the molecular formula C31H30FN2O6S3+ and a molecular weight of 641.79 g/mol. Its IUPAC name is 2-[2-[[5,5-dimethyl-3-[[1-(3-sulfopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]cyclohexen-1-yl]methylidene]-5-fluoro-1,3-benzothiazol-3-yl]acetic acid.
| Compound Name | 2-[2-[[5,5-dimethyl-3-[[1-(3-sulfopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]cyclohexen-1-yl]methylidene]-5-fluoro-1,3-benzothiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 72519824 |
| Molecular Formula | C31H30FN2O6S3+ |
| Molecular Weight | 641.79 g/mol |
| Exact Mass | 641.12 |
| IUPAC Name | 2-[2-[[5,5-dimethyl-3-[[1-(3-sulfopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]cyclohexen-1-yl]methylidene]-5-fluoro-1,3-benzothiazol-3-yl]acetic acid |
| SMILES | CC1(C)CC(C=C2Sc3ccc(F)cc3N2CC(=O)O)=CC(=Cc2sc3ccc4occc4c3[n+]2CCCS(=O)(=O)O)C1 |
| InChI | InChI=1S/C31H29FN2O6S3/c1-31(2)16-19(12-20(17-31)14-28-34(18-29(35)36)23-15-21(32)4-6-25(23)41-28)13-27-33(9-3-11-43(37,38)39)30-22-8-10-40-24(22)5-7-26(30)42-27/h4-8,10,12-15H,3,9,11,16-18H2,1-2H3,(H-,35,36,37,38,39)/p+1 |
| InChIKey | VMMUSPFZKJJJCY-UHFFFAOYSA-O |
| XLogP | 7.02 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.79 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|