About 2-methylbenzene-1,4-diamine
2-methylbenzene-1,4-diamine (PubChem CID 7252) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 2-methylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-methylbenzene-1,4-diamine |
| PubChem CID | 7252 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 2-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)ccc1N |
| InChI | InChI=1S/C7H10N2/c1-5-4-6(8)2-3-7(5)9/h2-4H,8-9H2,1H3 |
| InChIKey | OBCSAIDCZQSFQH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzene-1,4-diamine?
The IUPAC name of 2-methylbenzene-1,4-diamine (CID 7252) is 2-methylbenzene-1,4-diamine.
What is the SMILES notation for 2-methylbenzene-1,4-diamine?
The canonical SMILES for 2-methylbenzene-1,4-diamine is Cc1cc(N)ccc1N.
What is the InChIKey of 2-methylbenzene-1,4-diamine?
The InChIKey is OBCSAIDCZQSFQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-5-4-6(8)2-3-7(5)9/h2-4H,8-9H2,1H3.
What are the key properties of 2-methylbenzene-1,4-diamine?
2-methylbenzene-1,4-diamine has a molecular weight of 122.17 g/mol, XLogP of 1.16, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzene-1,4-diamine is sourced from PubChem (CID 7252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).