C26H31F3N6O4SSi — CID 72520185
2-[2-[1-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoroprop-1-enyl]-N-methyl-4-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoyl]anilino]acetic acid (PubChem CID 72520185) has the molecular formula C26H31F3N6O4SSi and a molecular weight of 608.72 g/mol. Its IUPAC name is 2-[2-[1-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoroprop-1-enyl]-N-methyl-4-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoyl]anilino]acetic acid.
| Compound Name | 2-[2-[1-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoroprop-1-enyl]-N-methyl-4-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoyl]anilino]acetic acid |
|---|---|
| PubChem CID | 72520185 |
| Molecular Formula | C26H31F3N6O4SSi |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | 2-[2-[1-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoroprop-1-enyl]-N-methyl-4-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoyl]anilino]acetic acid |
| SMILES | CN(CC(=O)O)c1ccc(C(=O)Nc2cccc(-n3[nH]nnc3=S)c2)cc1C(=CC(F)(F)F)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H31F3N6O4SSi/c1-25(2,3)41(5,6)39-21(14-26(27,28)29)19-12-16(10-11-20(19)34(4)15-22(36)37)23(38)30-17-8-7-9-18(13-17)35-24(40)31-32-33-35/h7-14H,15H2,1-6H3,(H,30,38)(H,36,37)(H,31,33,40) |
| InChIKey | QQUGTDAYDAIMEV-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|