C11H14O4 — CID 72524953
7-(hydroxymethyl)-1-methyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid (PubChem CID 72524953) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 7-(hydroxymethyl)-1-methyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid.
| Compound Name | 7-(hydroxymethyl)-1-methyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 72524953 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 7-(hydroxymethyl)-1-methyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
| SMILES | CC1OC=C(C(=O)O)C2CC=C(CO)C12 |
| InChI | InChI=1S/C11H14O4/c1-6-10-7(4-12)2-3-8(10)9(5-15-6)11(13)14/h2,5-6,8,10,12H,3-4H2,1H3,(H,13,14) |
| InChIKey | ZUQOROREPDUUER-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|