C16H31N5O2S — CID 7252767
2-[[4-butyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide (PubChem CID 7252767) has the molecular formula C16H31N5O2S and a molecular weight of 357.52 g/mol. Its IUPAC name is 2-[[4-butyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[4-butyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 7252767 |
| Molecular Formula | C16H31N5O2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 2-[[4-butyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCCCn1c(SCC(=O)NCCOC)nnc1[C@@H](CC)N(C)C |
| InChI | InChI=1S/C16H31N5O2S/c1-6-8-10-21-15(13(7-2)20(3)4)18-19-16(21)24-12-14(22)17-9-11-23-5/h13H,6-12H2,1-5H3,(H,17,22)/t13-/m1/s1 |
| InChIKey | XDEOMBZKYJZWAT-CYBMUJFWSA-N |
| XLogP | 1.95 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|