C19H20FN2O4S+ — CID 72528545
4-[2-(2-anilinoethenyl)-6-fluoro-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 72528545) has the molecular formula C19H20FN2O4S+ and a molecular weight of 391.44 g/mol. Its IUPAC name is 4-[2-(2-anilinoethenyl)-6-fluoro-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-(2-anilinoethenyl)-6-fluoro-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 72528545 |
| Molecular Formula | C19H20FN2O4S+ |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 4-[2-(2-anilinoethenyl)-6-fluoro-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCC[n+]1c(C=CNc2ccccc2)oc2cc(F)ccc21 |
| InChI | InChI=1S/C19H19FN2O4S/c20-15-8-9-17-18(14-15)26-19(10-11-21-16-6-2-1-3-7-16)22(17)12-4-5-13-27(23,24)25/h1-3,6-11,14H,4-5,12-13H2,(H,23,24,25)/p+1 |
| InChIKey | UYUJSMXYEMGATF-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|