About 2-methylbenzene-1,4-diol
2-methylbenzene-1,4-diol (PubChem CID 7253) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is 2-methylbenzene-1,4-diol.
Molecular Properties
| Compound Name | 2-methylbenzene-1,4-diol |
| PubChem CID | 7253 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 2-methylbenzene-1,4-diol |
| SMILES | Cc1cc(O)ccc1O |
| InChI | InChI=1S/C7H8O2/c1-5-4-6(8)2-3-7(5)9/h2-4,8-9H,1H3 |
| InChIKey | CNHDIAIOKMXOLK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzene-1,4-diol?
The IUPAC name of 2-methylbenzene-1,4-diol (CID 7253) is 2-methylbenzene-1,4-diol.
What is the SMILES notation for 2-methylbenzene-1,4-diol?
The canonical SMILES for 2-methylbenzene-1,4-diol is Cc1cc(O)ccc1O.
What is the InChIKey of 2-methylbenzene-1,4-diol?
The InChIKey is CNHDIAIOKMXOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c1-5-4-6(8)2-3-7(5)9/h2-4,8-9H,1H3.
What are the key properties of 2-methylbenzene-1,4-diol?
2-methylbenzene-1,4-diol has a molecular weight of 124.14 g/mol, XLogP of 1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzene-1,4-diol is sourced from PubChem (CID 7253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).